cas: 10314-06-4 — see every product listed under this CAS number, including other names
N,N-Phthaloyl-GABA chloride, 95% (CAS 10314-06-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F520918-1G |
| cas | 10314-06-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 659.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(1,3-dioxoisoindol-2-yl)butanoyl chloride (CAS 10314-06-4) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)butanoyl chloride. InChIKey: STXHPGKNMJVJKL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)butanoyl chloride |
| InChIKey | STXHPGKNMJVJKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCC(=O)Cl |
Computed by PubChem (NCBI)