cas: 22106-33-8 — see every product listed under this CAS number, including other names
4-(1H-Pyrrol-1-yl)benzoic acid, ≥99%, ≥99% (CAS 22106-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCMR-250mg |
| cas | 22106-33-8 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 1005.20 Pln |
| purity | ≥99% |
|---|---|
| delivery time | 3 weeks |
4-pyrrol-1-ylbenzoic acid (CAS 22106-33-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 4-pyrrol-1-ylbenzoic acid. InChIKey: NLSIIPKSANRIGS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 4-pyrrol-1-ylbenzoic acid |
| InChIKey | NLSIIPKSANRIGS-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)