CAS 22106-33-8 appears in our catalog under these names: 4-(1H-Pyrrol-1-yl)benzoic acid, 96%, 4-(1H-Pyrrol-1-yl)benzoic acid, 98%, 4-(1H-Pyrrol-1-yl)benzoic acid, ≥99%, ≥99%, 4-(1-PYRROLYL)BENZOIC ACID, 99%(LC-MS),RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g.
4-pyrrol-1-ylbenzoic acid (CAS 22106-33-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 4-pyrrol-1-ylbenzoic acid. InChIKey: NLSIIPKSANRIGS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 4-pyrrol-1-ylbenzoic acid |
| InChIKey | NLSIIPKSANRIGS-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)