cas: 913835-36-6 — see every product listed under this CAS number, including other names
4-(2,3-Dimethylphenylcarbamoyl)phenylboronic acid 98% (CAS 913835-36-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A673679-250mg |
| cas | 913835-36-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A673679 |
[4-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid (CAS 913835-36-6) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [4-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: XMQJSFXFADVYRR-UHFFFAOYSA-N.
| Molecular formula | C15H16BNO3 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | [4-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | XMQJSFXFADVYRR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=CC(=C2C)C)(O)O |
Computed by PubChem (NCBI)