cas: 93012-66-9 — see every product listed under this CAS number, including other names
4-(2,5-Dimethoxybenzoyl)benzoic acid, 98%, 98% (CAS 93012-66-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GS8V-100mg |
| cas | 93012-66-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 990.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(2,5-dimethoxybenzoyl)benzoic acid (CAS 93012-66-9) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 4-(2,5-dimethoxybenzoyl)benzoic acid. InChIKey: SFMJTPNGPIXLOL-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 4-(2,5-dimethoxybenzoyl)benzoic acid |
| InChIKey | SFMJTPNGPIXLOL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)