Products 31139-36-3
CAS 31139-36-3 appears in our catalog under these names: Dibenzyl dicarbonate, 97%, Dibenzyl Dicarbonate, Dibenzyl Dicarbonate, Dibenzyl Dicarbona 97%, Dibenzyl pyrocarbonate, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 2,5g, 10g, 250mg.
Benzyl phenylmethoxycarbonyl carbonate (CAS 31139-36-3) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: benzyl phenylmethoxycarbonyl carbonate. InChIKey: FHRRJZZGSJXPRQ-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | benzyl phenylmethoxycarbonyl carbonate |
| InChIKey | FHRRJZZGSJXPRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)OC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)