CAS 14387-30-5 appears in our catalog under these names: Dimethyl 4,4'-oxydibenzoate, 95%, Dimethyl-4',4-oxybis(benzoate). Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg.
Methyl 4-(4-methoxycarbonylphenoxy)benzoate (CAS 14387-30-5) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: methyl 4-(4-methoxycarbonylphenoxy)benzoate. InChIKey: CGARGJZZBOHMIZ-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | methyl 4-(4-methoxycarbonylphenoxy)benzoate |
| InChIKey | CGARGJZZBOHMIZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)