CAS 93012-66-9 appears in our catalog under these names: 4-(2,5-Dimethoxybenzoyl)benzoic acid, 95%, 4-(2,5-Dimethoxybenzoyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.
4-(2,5-dimethoxybenzoyl)benzoic acid (CAS 93012-66-9) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 4-(2,5-dimethoxybenzoyl)benzoic acid. InChIKey: SFMJTPNGPIXLOL-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 4-(2,5-dimethoxybenzoyl)benzoic acid |
| InChIKey | SFMJTPNGPIXLOL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)