Products 53478-05-0
CAS 53478-05-0 is the registry number for 3-(Benzyloxy)-5-(methoxycarbonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-methoxycarbonyl-5-phenylmethoxybenzoic acid (CAS 53478-05-0) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 3-methoxycarbonyl-5-phenylmethoxybenzoic acid. InChIKey: DZFVWJYZLRTFMO-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 3-methoxycarbonyl-5-phenylmethoxybenzoic acid |
| InChIKey | DZFVWJYZLRTFMO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3-(benzyloxy)-5-(methoxycarbonyl)benzoic acid, 5-Benzyloxy-isophthalic acid monomethyl ester, DZFVWJYZLRTFMO-UHFFFAOYSA-N, 3-benzyloxy-5-methoxycarbonyl-benzoic acid, 5-Benzyloxyisophthalic acid monomethyl ester, 3-methoxycarbonyl-5-phenylmethoxybenzoic acid, 3-(benzyloxy)-5-(methoxycarbonyl)benzoicacid, 1-Methyl 5-(phenylmethoxy)-1,3-benzenedicarboxylate