CAS 1707575-03-8 appears in our catalog under these names: 3-((2,3-Difluorophenyl)methoxy)pyridine, 95%, 3-((2,3-Difluorophenyl)methoxy)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-[(2,3-difluorophenyl)methoxy]pyridine (CAS 1707575-03-8) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: 3-[(2,3-difluorophenyl)methoxy]pyridine. InChIKey: MBFKSVGJPKSQII-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | 3-[(2,3-difluorophenyl)methoxy]pyridine |
| InChIKey | MBFKSVGJPKSQII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)COC2=CN=CC=C2 |
Computed by PubChem (NCBI)