CAS 1335512-15-6 is the registry number for (2-Fluoro-5-(2-fluoropyridin-3-yl)phenyl)methanol, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
[2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]methanol (CAS 1335512-15-6) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: [2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]methanol. InChIKey: FKNGEMJDNRBZGD-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | [2-fluoro-5-(2-fluoro-3-pyridinyl)phenyl]methanol |
| InChIKey | FKNGEMJDNRBZGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)F)C2=CC(=C(C=C2)F)CO |
Computed by PubChem (NCBI)