cas: 41900-13-4 — see every product listed under this CAS number, including other names
4-(2-Bromoethyl)-1,1'-biphenyl, 97% (CAS 41900-13-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1326643-1g |
| cas | 41900-13-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6671.14 Pln | |
| AmBeed | 5g | 19619.53 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2-bromoethyl)-4-phenylbenzene (CAS 41900-13-4) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 1-(2-bromoethyl)-4-phenylbenzene. InChIKey: IDGZWZOGXPFMAL-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 1-(2-bromoethyl)-4-phenylbenzene |
| InChIKey | IDGZWZOGXPFMAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CCBr |
Computed by PubChem (NCBI)