cas: 99983-26-3 — see every product listed under this CAS number, including other names
4-(2-Bromophenyl)piperidine-2,6-dione, 98% (CAS 99983-26-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A299651-5g |
| cas | 99983-26-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7855.96 Pln | |
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 5g | 4902.46 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(2-bromophenyl)piperidine-2,6-dione (CAS 99983-26-3) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 4-(2-bromophenyl)piperidine-2,6-dione. InChIKey: JELSMZSISXNIMR-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-(2-bromophenyl)piperidine-2,6-dione |
| InChIKey | JELSMZSISXNIMR-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)