CAS 351534-35-5 appears in our catalog under these names: 4-(3-Bromo-phenyl)-piperidine-2,6-dione, 97%, 4–(3–BROMO–PHENYL)–PIPERIDINE–2,6–DIONE, 4-(3-Bromophenyl)piperidine-2,6-dione, 96%, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
4-(3-bromophenyl)piperidine-2,6-dione (CAS 351534-35-5) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 4-(3-bromophenyl)piperidine-2,6-dione. InChIKey: XKLMZPIKSUMFTO-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-(3-bromophenyl)piperidine-2,6-dione |
| InChIKey | XKLMZPIKSUMFTO-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)