CAS 60207-22-9 is the registry number for 4-[2-(Bromomethyl)-1,3-dioxolan-2-yl]benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-[2-(bromomethyl)-1,3-dioxolan-2-yl]benzonitrile (CAS 60207-22-9) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 4-[2-(bromomethyl)-1,3-dioxolan-2-yl]benzonitrile. InChIKey: UPIQMVADUQYNGB-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-[2-(bromomethyl)-1,3-dioxolan-2-yl]benzonitrile |
| InChIKey | UPIQMVADUQYNGB-UHFFFAOYSA-N |
| SMILES | C1COC(O1)(CBr)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)