Products 99983-26-3
CAS 99983-26-3 appears in our catalog under these names: 4-(2-Bromophenyl)piperidine-2,6-dione, 95%, 4-(2-Bromophenyl)piperidine-2,6-dione, 98%, 4-(2-Bromophenyl)piperidine-2,6-dione, 4-(2-Bromophenyl)piperidine-2,6-dione, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 100mg, 250mg.
4-(2-bromophenyl)piperidine-2,6-dione (CAS 99983-26-3) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 4-(2-bromophenyl)piperidine-2,6-dione. InChIKey: JELSMZSISXNIMR-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-(2-bromophenyl)piperidine-2,6-dione |
| InChIKey | JELSMZSISXNIMR-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)