Products 71987-66-1
CAS 71987-66-1 appears in our catalog under these names: 2-(5-Bromo-2-methyl-1h-indol-3-yl)acetic acid, 95%, 2-(5-bromo-2-methyl-1H-indol-3-yl)acetic acid, 2-(5-Bromo-2-methyl-1H-indol-3-yl)acetic acid 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
2-(5-bromo-2-methyl-1H-indol-3-yl)acetic acid (CAS 71987-66-1) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 2-(5-bromo-2-methyl-1H-indol-3-yl)acetic acid. InChIKey: GYMIIVHLZZZWAD-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 2-(5-bromo-2-methyl-1H-indol-3-yl)acetic acid |
| InChIKey | GYMIIVHLZZZWAD-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)Br)CC(=O)O |
Computed by PubChem (NCBI)