cas: 3179-08-6 — see every product listed under this CAS number, including other names
4-(2-Nitrovinyl)Phenol, 98%, 98% (CAS 3179-08-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1IJ-250mg |
| cas | 3179-08-6 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 429.20 Pln | |
| Chemat | 25g | 717.20 Pln | |
| Chemat | 100g | 2685.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[(E)-2-nitroethenyl]phenol (CAS 3179-08-6) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 4-[(E)-2-nitroethenyl]phenol. InChIKey: CTJKRKMPTRJAIT-AATRIKPKSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 4-[(E)-2-nitroethenyl]phenol |
| InChIKey | CTJKRKMPTRJAIT-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])O |
Computed by PubChem (NCBI)