cas: 3179-08-6 — see every product listed under this CAS number, including other names
4-Hydroxy-b-nitrostyrene, 95% (CAS 3179-08-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018725-250MG |
| cas | 3179-08-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 10g | 685.19 Pln | |
| Fluorochem | 25g | 1164.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[(E)-2-nitroethenyl]phenol (CAS 3179-08-6) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 4-[(E)-2-nitroethenyl]phenol. InChIKey: CTJKRKMPTRJAIT-AATRIKPKSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 4-[(E)-2-nitroethenyl]phenol |
| InChIKey | CTJKRKMPTRJAIT-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])O |
Computed by PubChem (NCBI)