4-(2-Oxo-2-phenylethyl)benzoic acid, 95%
cas: 346623-13-0 — see every product listed under this CAS number, including other names
4-(2-Oxo-2-phenylethyl)benzoic acid, 95% (CAS 346623-13-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A777270-250mg |
| cas | 346623-13-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 737.50 Pln | |
| Ambeed | 1g | 1866.69 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 725.32 Pln | |
| BLDpharm | 1g | 1830.49 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1571.60 Pln | |
| Fluorochem | 1g | 2923.99 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-phenacylbenzoic acid (CAS 346623-13-0) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 4-phenacylbenzoic acid. InChIKey: YVPSKWZULNRWJN-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 4-phenacylbenzoic acid |
| InChIKey | YVPSKWZULNRWJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)