CAS 669713-90-0 appears in our catalog under these names: (4'-Formyl-biphenyl-4-yl)-acetic acid, 95%, (4'-Formyl-biphenyl-4-yl)-acetic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg.
2-[4-(4-formylphenyl)phenyl]acetic acid (CAS 669713-90-0) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2-[4-(4-formylphenyl)phenyl]acetic acid. InChIKey: VRIMIPHUAHCGAI-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2-[4-(4-formylphenyl)phenyl]acetic acid |
| InChIKey | VRIMIPHUAHCGAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)