CAS 386297-59-2 appears in our catalog under these names: methyl 3-(3-formylphenyl)benzoate, 95%, Methyl 3'-formyl-[1,1'-biphenyl]-3-carboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
Methyl 3-(3-formylphenyl)benzoate (CAS 386297-59-2) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: methyl 3-(3-formylphenyl)benzoate. InChIKey: CPAIYDIGLIGAEN-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | methyl 3-(3-formylphenyl)benzoate |
| InChIKey | CPAIYDIGLIGAEN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)