Products 22071-22-3
CAS 22071-22-3 appears in our catalog under these names: 3–Benzoylphenylacetic Acid, 3-Benzoylphenylacetic acid, 95%, (3-Benzoylphenyl)acetic Acid, 3-Benzoylphenylacetic acid, 97%, Benzeneacetic acid, 3-benzoyl-, 97%, 97%. Offered by: GLPBio, Combi-blocks, Mikromol, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 25mg, 5g, on request, 50mg, 10mM (in 1ml dmso).
2-(3-benzoylphenyl)acetic acid (CAS 22071-22-3) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2-(3-benzoylphenyl)acetic acid. InChIKey: ALDSXDRDRWDASQ-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2-(3-benzoylphenyl)acetic acid |
| InChIKey | ALDSXDRDRWDASQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Benzoylphenylacetic acid, 2-(3-Benzoylphenyl)acetic acid, (3-Benzoylphenyl)acetic acid, 3-Benzoylbenzeneacetic acid, KETOPROFEN IMPURITY B [EP IMPURITY], KETOPROFEN IMPURITY B (EP IMPURITY), ALDSXDRDRWDASQ-UHFFFAOYSA-N, Desmethyl Ketoprofen, Benzeneacetic acid, 3-benzoyl-, Ketoprofen EP Impurity B