CAS 728918-66-9 appears in our catalog under these names: 3'-Acetylbiphenyl-3-carboxylic acid, 96%, 3'-Acetyl-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(3-acetylphenyl)benzoic acid (CAS 728918-66-9) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 3-(3-acetylphenyl)benzoic acid. InChIKey: NJNGKNDRAKDMQB-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 3-(3-acetylphenyl)benzoic acid |
| InChIKey | NJNGKNDRAKDMQB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)