cas: 5333-34-6 — see every product listed under this CAS number, including other names
4-(3,4-Dimethoxyphenyl)-4-oxobutanoic acid, 95%, 95% (CAS 5333-34-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K1S-100mg |
| cas | 5333-34-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 438.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid (CAS 5333-34-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid. InChIKey: BUAYFJKMVBIPKA-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid |
| InChIKey | BUAYFJKMVBIPKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CCC(=O)O)OC |
Computed by PubChem (NCBI)