cas: 1007578-99-5 — see every product listed under this CAS number, including other names
4-(3-Bromophenyl)-1H-1,2,4-triazol-5(4H)-one, 97% (CAS 1007578-99-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A695380-10g |
| cas | 1007578-99-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12425.98 Pln | |
| AmBeed | 5g | 7094.29 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(3-bromophenyl)-1H-1,2,4-triazol-5-one (CAS 1007578-99-5) is a chemical compound with the molecular formula C8H6BrN3O and a molecular weight of 240.06 g/mol. IUPAC name: 4-(3-bromophenyl)-1H-1,2,4-triazol-5-one. InChIKey: VNHDGUPBGGDJDJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 4-(3-bromophenyl)-1H-1,2,4-triazol-5-one |
| InChIKey | VNHDGUPBGGDJDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=NNC2=O |
Computed by PubChem (NCBI)