CAS 1007578-99-5 appears in our catalog under these names: 4-(3-Bromophenyl)-2,4-dihydro-3h-1,2,4-triazol-3-one, 95%, 4-(3-Bromophenyl)-1H-1,2,4-triazol-5(4H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 1g, 5g.
4-(3-bromophenyl)-1H-1,2,4-triazol-5-one (CAS 1007578-99-5) is a chemical compound with the molecular formula C8H6BrN3O and a molecular weight of 240.06 g/mol. IUPAC name: 4-(3-bromophenyl)-1H-1,2,4-triazol-5-one. InChIKey: VNHDGUPBGGDJDJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 4-(3-bromophenyl)-1H-1,2,4-triazol-5-one |
| InChIKey | VNHDGUPBGGDJDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=NNC2=O |
Computed by PubChem (NCBI)