CAS 1228666-56-5 appears in our catalog under these names: 7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4-ol, 97%, 7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4-ol, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
7-bromo-2-methyl-3H-pyrido[3,2-d]pyrimidin-4-one (CAS 1228666-56-5) is a chemical compound with the molecular formula C8H6BrN3O and a molecular weight of 240.06 g/mol. IUPAC name: 7-bromo-2-methyl-3H-pyrido[3,2-d]pyrimidin-4-one. InChIKey: SUAHOXUNIGVBOJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 7-bromo-2-methyl-3H-pyrido[3,2-d]pyrimidin-4-one |
| InChIKey | SUAHOXUNIGVBOJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=O)N1)N=CC(=C2)Br |
Computed by PubChem (NCBI)