CAS 33199-41-6 appears in our catalog under these names: 5-(4-Bromophenyl)-2h-1,2,4-triazol-3(4h)-one, 95%, 3-(4-Bromophenyl)-1H-1,2,4-triazol-5(4H)-one, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-(4-bromophenyl)-1,4-dihydro-1,2,4-triazol-5-one (CAS 33199-41-6) is a chemical compound with the molecular formula C8H6BrN3O and a molecular weight of 240.06 g/mol. IUPAC name: 3-(4-bromophenyl)-1,4-dihydro-1,2,4-triazol-5-one. InChIKey: CFRHDMJAUMODNV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1,4-dihydro-1,2,4-triazol-5-one |
| InChIKey | CFRHDMJAUMODNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)N2)Br |
Computed by PubChem (NCBI)