Products 33621-62-4
CAS 33621-62-4 appears in our catalog under these names: 5-(4-Bromophenyl)-1,3,4-oxadiazol-2-amine, 5-(4-Bromophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(4-Bromophenyl)-1,3,4-oxadiazol-2-amine, 95+%, 5-(4-Bromophenyl)-1,3,4-oxadiazol-2-amine, 95%, 95%. Offered by: Biosynth, Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 25g, 10g.
5-(4-bromophenyl)-1,3,4-oxadiazol-2-amine (CAS 33621-62-4) is a chemical compound with the molecular formula C8H6BrN3O and a molecular weight of 240.06 g/mol. IUPAC name: 5-(4-bromophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: UNSGGKLETSYTPE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | UNSGGKLETSYTPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)N)Br |
Computed by PubChem (NCBI)