cas: 1391052-66-6 — see every product listed under this CAS number, including other names
4-(3-CHLOROBENZOYL) PIPERIDINE HCL, 95% (CAS 1391052-66-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306870-250MG |
| cas | 1391052-66-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 778.91 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 1391052-66-6) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: (3-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: NOFTZHLEMWXDOE-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (3-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | NOFTZHLEMWXDOE-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)