cas: 56183-35-8 — see every product listed under this CAS number, including other names
4-(3-Hydroxyphenoxy)benzoic acid, 98% (CAS 56183-35-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg, 2.5g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QF-4535-1g |
| cas | 56183-35-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| AmBeed | 100mg | 245.77 Pln | |
| AmBeed | 10g | 4366.60 Pln | |
| AmBeed | 250mg | 369.46 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 2.5g | 789.32 Pln | |
| Fluorochem | 5g | 935.11 Pln | |
| Fluorochem | 10g | 1815.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-(3-hydroxyphenoxy)benzoic acid (CAS 56183-35-8) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 4-(3-hydroxyphenoxy)benzoic acid. InChIKey: DEDKCEDXZJIDKZ-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-(3-hydroxyphenoxy)benzoic acid |
| InChIKey | DEDKCEDXZJIDKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)