CAS 444068-62-6 appears in our catalog under these names: 4-(5-Formylfuran-2-yl)-3-methylbenzoic acid, 98%, 4-(5-Formylfuran-2-yl)-3-methylbenzoic acid, 4-(5-Formylfuran-2-yl)-3-methylbenzoic acid, 98%, 98%. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 50mg, 0,5g, 100mg.
4-(5-formylfuran-2-yl)-3-methylbenzoic acid (CAS 444068-62-6) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 4-(5-formylfuran-2-yl)-3-methylbenzoic acid. InChIKey: FDTLOWDUZAUBOK-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-(5-formylfuran-2-yl)-3-methylbenzoic acid |
| InChIKey | FDTLOWDUZAUBOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)