cas: 473706-26-2 — see every product listed under this CAS number, including other names
4-(3-Methoxyphenyl)tetrahydro-2H-pyran-4-carboxylic acid 95% (CAS 473706-26-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A707588-100mg |
| cas | 473706-26-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 2795.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A707588 |
4-(3-methoxyphenyl)oxane-4-carboxylic acid (CAS 473706-26-2) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 4-(3-methoxyphenyl)oxane-4-carboxylic acid. InChIKey: PLSSMXYQFFSRMT-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)oxane-4-carboxylic acid |
| InChIKey | PLSSMXYQFFSRMT-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2(CCOCC2)C(=O)O |
Computed by PubChem (NCBI)