CAS 104141-93-7 is the registry number for tert-Butyl methyl terephthalate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-O-tert-butyl 1-O-methyl benzene-1,4-dicarboxylate (CAS 104141-93-7) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl benzene-1,4-dicarboxylate. InChIKey: BZSIMKLZANLUDE-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl benzene-1,4-dicarboxylate |
| InChIKey | BZSIMKLZANLUDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)