Products 1020999-22-7
CAS 1020999-22-7 appears in our catalog under these names: 4-(Oxan-2-ylmethoxy)benzoic acid, 95%, 4–((Tetrahydro–2H–pyran–2–yl)methoxy)benzoic acid, 4-((Tetrahydro-2H-pyran-2-yl)methoxy)benzoic acid 97%, 4-((Tetrahydro-2H-pyran-2-yl)methoxy)benzoic acid, 97%, 97%, 4-((Tetrahydro-2H-pyran-2-yl)methoxy)benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(oxan-2-ylmethoxy)benzoic acid (CAS 1020999-22-7) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 4-(oxan-2-ylmethoxy)benzoic acid. InChIKey: MGARNVXPLJRSIZ-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 4-(oxan-2-ylmethoxy)benzoic acid |
| InChIKey | MGARNVXPLJRSIZ-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)COC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)