Products 42174-79-8

CAS 42174-79-8 is the registry number for 3,5-Dimethoxycinnamic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (CAS 42174-79-8) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: ethyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate. InChIKey: BYIUFYLSBXPKEU-AATRIKPKSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC nameethyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate
InChIKeyBYIUFYLSBXPKEU-AATRIKPKSA-N
SMILESCCOC(=O)/C=C/C1=CC(=CC(=C1)OC)OC

Computed by PubChem (NCBI)