CAS 40542-90-3 appears in our catalog under these names: Adipic acid monobenzyl ester, 97%, Monobenzyl Adipate, >95% (HPLC), ADIPIC ACID MONOBENZYL ESTER, 6-(Benzyloxy)-6-oxohexanoic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100g, 500g.
6-oxo-6-phenylmethoxyhexanoic acid (CAS 40542-90-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 6-oxo-6-phenylmethoxyhexanoic acid. InChIKey: CQSWISNVQPOAEM-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 6-oxo-6-phenylmethoxyhexanoic acid |
| InChIKey | CQSWISNVQPOAEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)