cas: 60875-16-3 — see every product listed under this CAS number, including other names
4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid, 99.0% (CAS 60875-16-3) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W014078-5 g |
| cas | 60875-16-3 |
| size | 5 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 695.86 Pln | |
| MedChemExpress | 10 g | 1044.16 Pln | |
| MedChemExpress | 1 g | 352.20 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.0% |
4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzoic acid (CAS 60875-16-3) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzoic acid. InChIKey: CUGBBQWDGCXWNB-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzoic acid |
| InChIKey | CUGBBQWDGCXWNB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)