cas: 60875-16-3 — see every product listed under this CAS number, including other names
4-(3-Methyl-5-oxo-4,5-dihydro-pyrazol-1-yl)-benzoic acid, 95% (CAS 60875-16-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060993-5G |
| cas | 60875-16-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 25g | 1533.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzoic acid (CAS 60875-16-3) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzoic acid. InChIKey: CUGBBQWDGCXWNB-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzoic acid |
| InChIKey | CUGBBQWDGCXWNB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)