cas: 116922-22-6 — see every product listed under this CAS number, including other names
4-(3-Nitrophenyl)morpholine, 98+%, 98+% (CAS 116922-22-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111DDH-250mg |
| cas | 116922-22-6 |
| size | 250mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 25g | 899.60 Pln | |
| Chemat | 10g | 395.60 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
4-(3-nitrophenyl)morpholine (CAS 116922-22-6) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(3-nitrophenyl)morpholine. InChIKey: DKECFAGKGYRYAT-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(3-nitrophenyl)morpholine |
| InChIKey | DKECFAGKGYRYAT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)