cas: 406233-26-9 — see every product listed under this CAS number, including other names
4-(4,4-Dimethylpiperidin-1-yl)benzoic acid 95% (CAS 406233-26-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A101650-5g |
| cas | 406233-26-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 3151.62 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 837.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A101650 |
4-(4,4-dimethylpiperidin-1-yl)benzoic acid (CAS 406233-26-9) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 4-(4,4-dimethylpiperidin-1-yl)benzoic acid. InChIKey: MNGVOIOJCKRYCZ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 4-(4,4-dimethylpiperidin-1-yl)benzoic acid |
| InChIKey | MNGVOIOJCKRYCZ-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)