cas: 406233-26-9 — see every product listed under this CAS number, including other names
4-(4,4-Dimethylpiperidin-1-yl)benzoic acid, 95%, 95% (CAS 406233-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187DH-100mg |
| cas | 406233-26-9 |
| size | 100mg |
| availability | 2.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 194.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4,4-dimethylpiperidin-1-yl)benzoic acid (CAS 406233-26-9) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 4-(4,4-dimethylpiperidin-1-yl)benzoic acid. InChIKey: MNGVOIOJCKRYCZ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 4-(4,4-dimethylpiperidin-1-yl)benzoic acid |
| InChIKey | MNGVOIOJCKRYCZ-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)