cas: 649553-07-1 — see every product listed under this CAS number, including other names
4-(4-(Hydroxymethyl)phenoxy)phthalonitrile, 97%, 97% (CAS 649553-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELEH-100mg |
| cas | 649553-07-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 827.60 Pln | |
| Chemat | 5g | 2358.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[4-(hydroxymethyl)phenoxy]benzene-1,2-dicarbonitrile (CAS 649553-07-1) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 4-[4-(hydroxymethyl)phenoxy]benzene-1,2-dicarbonitrile. InChIKey: NCTXRQVAZBODIP-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 4-[4-(hydroxymethyl)phenoxy]benzene-1,2-dicarbonitrile |
| InChIKey | NCTXRQVAZBODIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)OC2=CC(=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)