cas: 649553-07-1 — see every product listed under this CAS number, including other names
4-(4-(Hydroxymethyl)phenoxy)phthalonitrile, 97% (CAS 649553-07-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A605709-5g |
| cas | 649553-07-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10310.23 Pln | |
| AmBeed | 10g | 12458.53 Pln | |
| Fluorochem | 10g | 4808.74 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[4-(hydroxymethyl)phenoxy]benzene-1,2-dicarbonitrile (CAS 649553-07-1) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 4-[4-(hydroxymethyl)phenoxy]benzene-1,2-dicarbonitrile. InChIKey: NCTXRQVAZBODIP-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 4-[4-(hydroxymethyl)phenoxy]benzene-1,2-dicarbonitrile |
| InChIKey | NCTXRQVAZBODIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)OC2=CC(=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)