CAS 162135-93-5 is the registry number for 3-Phenylquinoxaline-5-carboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-phenylquinoxaline-5-carboxylic acid (CAS 162135-93-5) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 3-phenylquinoxaline-5-carboxylic acid. InChIKey: OIVGUXVBKAIKBI-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 3-phenylquinoxaline-5-carboxylic acid |
| InChIKey | OIVGUXVBKAIKBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC=C3N=C2)C(=O)O |
Computed by PubChem (NCBI)