cas: 22525-43-5 — see every product listed under this CAS number, including other names
4-(4-Aminostyryl)-N,N-dimethylaniline, 97%(GC-MS),RG, 97%(GC-MS),RG (CAS 22525-43-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KPU-100mg |
| cas | 22525-43-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1034.00 Pln |
| purity | 97%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline (CAS 22525-43-5) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: 4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline. InChIKey: GCHSJPKVJSMRDX-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline |
| InChIKey | GCHSJPKVJSMRDX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)