cas: 22525-43-5 — see every product listed under this CAS number, including other names
4-Amino-4'-(N,N-dimethylamino)stilbene, >98.0%(T) (CAS 22525-43-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0291-1G |
| cas | 22525-43-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 664.16 Pln | |
| TCI | 5g | 2065.58 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline (CAS 22525-43-5) is a chemical compound with the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. IUPAC name: 4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline. InChIKey: GCHSJPKVJSMRDX-UHFFFAOYSA-N.
| Molecular formula | C16H18N2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 4-[2-[4-(dimethylamino)phenyl]ethenyl]aniline |
| InChIKey | GCHSJPKVJSMRDX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)