cas: 906673-45-8 — see every product listed under this CAS number, including other names
4-(4-Bromo-3-(hydroxymethyl)phenoxy)benzonitrile, 98% (CAS 906673-45-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 250mg, 1g, 75g, 100g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F053897-5G |
| cas | 906673-45-8 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Fluorochem | 25g | 669.57 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 616.40 Pln | |
| Chemat | 75g | 1744.40 Pln | |
| Chemat | 100g | 1830.80 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-[4-bromo-3-(hydroxymethyl)phenoxy]benzonitrile (CAS 906673-45-8) is a chemical compound with the molecular formula C14H10BrNO2 and a molecular weight of 304.14 g/mol. IUPAC name: 4-[4-bromo-3-(hydroxymethyl)phenoxy]benzonitrile. InChIKey: DAMOSKSUIVLOJT-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO2 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 4-[4-bromo-3-(hydroxymethyl)phenoxy]benzonitrile |
| InChIKey | DAMOSKSUIVLOJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC(=C(C=C2)Br)CO |
Computed by PubChem (NCBI)