CAS 1983120-21-3 is the registry number for 9-Bromo-3-methoxybenzo[6,7]oxepino[3,2-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2-methoxy-[1]benzoxepino[3,2-b]pyridine (CAS 1983120-21-3) is a chemical compound with the molecular formula C14H10BrNO2 and a molecular weight of 304.14 g/mol. IUPAC name: 7-bromo-2-methoxy-[1]benzoxepino[3,2-b]pyridine. InChIKey: BXEVCICMHNJHBI-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO2 |
|---|---|
| Molecular weight | 304.14 g/mol |
| IUPAC name | 7-bromo-2-methoxy-[1]benzoxepino[3,2-b]pyridine |
| InChIKey | BXEVCICMHNJHBI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC3=C(O2)C=CC=C3Br)N=C1 |
Computed by PubChem (NCBI)